C17H18FN3 — CID 111044144
1-(2,3-dihydro-1H-inden-5-yl)-2-[(3-fluorophenyl)methyl]guanidine (PubChem CID 111044144) has the molecular formula C17H18FN3 and a molecular weight of 283.35 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(3-fluorophenyl)methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(3-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111044144 |
| Molecular Formula | C17H18FN3 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(3-fluorophenyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1cccc(F)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H18FN3/c18-15-6-1-3-12(9-15)11-20-17(19)21-16-8-7-13-4-2-5-14(13)10-16/h1,3,6-10H,2,4-5,11H2,(H3,19,20,21) |
| InChIKey | CETDTYJIJBIBIJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|