C16H17FN4 — CID 119164322
1-(2,3-dihydro-1H-inden-5-yl)-2-[(5-fluoro-2-pyridinyl)methyl]guanidine (PubChem CID 119164322) has the molecular formula C16H17FN4 and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(5-fluoro-2-pyridinyl)methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(5-fluoro-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 119164322 |
| Molecular Formula | C16H17FN4 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(5-fluoro-2-pyridinyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(F)cn1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H17FN4/c17-13-5-7-15(19-9-13)10-20-16(18)21-14-6-4-11-2-1-3-12(11)8-14/h4-9H,1-3,10H2,(H3,18,20,21) |
| InChIKey | ZRUFTCWUWVUORK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|