C17H17BrFN3 — CID 111064556
2-[(5-bromo-2-fluorophenyl)methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine (PubChem CID 111064556) has the molecular formula C17H17BrFN3 and a molecular weight of 362.25 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
|---|---|
| PubChem CID | 111064556 |
| Molecular Formula | C17H17BrFN3 |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
| SMILES | N/C(=N\Cc1cc(Br)ccc1F)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H17BrFN3/c18-14-5-7-16(19)13(8-14)10-21-17(20)22-15-6-4-11-2-1-3-12(11)9-15/h4-9H,1-3,10H2,(H3,20,21,22) |
| InChIKey | RQDDUGZMDNBMKB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|