C12H17BrFN3 — CID 55064147
2-[(5-bromo-2-fluorophenyl)methyl]-1-tert-butylguanidine (PubChem CID 55064147) has the molecular formula C12H17BrFN3 and a molecular weight of 302.19 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-1-tert-butylguanidine.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-tert-butylguanidine |
|---|---|
| PubChem CID | 55064147 |
| Molecular Formula | C12H17BrFN3 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-tert-butylguanidine |
| SMILES | CC(C)(C)N/C(N)=N/Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H17BrFN3/c1-12(2,3)17-11(15)16-7-8-6-9(13)4-5-10(8)14/h4-6H,7H2,1-3H3,(H3,15,16,17) |
| InChIKey | WKBPAMHDDNYODD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|