C8H10BrFN4 — CID 64866451
1-amino-2-[(5-bromo-2-fluorophenyl)methyl]guanidine (PubChem CID 64866451) has the molecular formula C8H10BrFN4 and a molecular weight of 261.10 g/mol. Its IUPAC name is 1-amino-2-[(5-bromo-2-fluorophenyl)methyl]guanidine.
| Compound Name | 1-amino-2-[(5-bromo-2-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 64866451 |
| Molecular Formula | C8H10BrFN4 |
| Molecular Weight | 261.10 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 1-amino-2-[(5-bromo-2-fluorophenyl)methyl]guanidine |
| SMILES | NN/C(N)=N/Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C8H10BrFN4/c9-6-1-2-7(10)5(3-6)4-13-8(11)14-12/h1-3H,4,12H2,(H3,11,13,14) |
| InChIKey | PPBXFQVFBLXYOY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.10 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|