C13H15BrFN3 — CID 111850360
2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine (PubChem CID 111850360) has the molecular formula C13H15BrFN3 and a molecular weight of 312.19 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111850360 |
| Molecular Formula | C13H15BrFN3 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/Cc1cc(Br)ccc1F)NCC |
| InChI | InChI=1S/C13H15BrFN3/c1-3-7-17-13(16-4-2)18-9-10-8-11(14)5-6-12(10)15/h1,5-6,8H,4,7,9H2,2H3,(H2,16,17,18) |
| InChIKey | JVMQXIZCNPMUQB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|