C17H27BrFN3O — CID 111713365
2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine (PubChem CID 111713365) has the molecular formula C17H27BrFN3O and a molecular weight of 388.33 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine |
|---|---|
| PubChem CID | 111713365 |
| Molecular Formula | C17H27BrFN3O |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine |
| SMILES | CCCC(CCO)CN/C(=N/Cc1cc(Br)ccc1F)NCC |
| InChI | InChI=1S/C17H27BrFN3O/c1-3-5-13(8-9-23)11-21-17(20-4-2)22-12-14-10-15(18)6-7-16(14)19/h6-7,10,13,23H,3-5,8-9,11-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | CVEFMEQOURYLQN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|