C13H19BrFN3 — CID 110926886
2-[2-(5-bromo-2-fluorophenyl)ethyl]-1,3-diethylguanidine (PubChem CID 110926886) has the molecular formula C13H19BrFN3 and a molecular weight of 316.22 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1,3-diethylguanidine.
| Compound Name | 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 110926886 |
| Molecular Formula | C13H19BrFN3 |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCCc1cc(Br)ccc1F)NCC |
| InChI | InChI=1S/C13H19BrFN3/c1-3-16-13(17-4-2)18-8-7-10-9-11(14)5-6-12(10)15/h5-6,9H,3-4,7-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | VRCGAUKUAMJSNK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|