C19H28BrFN4O2 — CID 111328522
ethyl 4-[[N'-[2-(5-bromo-2-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328522) has the molecular formula C19H28BrFN4O2 and a molecular weight of 443.36 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(5-bromo-2-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(5-bromo-2-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328522 |
| Molecular Formula | C19H28BrFN4O2 |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | ethyl 4-[[N'-[2-(5-bromo-2-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CCc1cc(Br)ccc1F)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H28BrFN4O2/c1-3-22-18(23-10-7-14-13-15(20)5-6-17(14)21)24-16-8-11-25(12-9-16)19(26)27-4-2/h5-6,13,16H,3-4,7-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | QSZOTQABRWSLKH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|