C21H35IN4O4 — CID 111327527
ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111327527) has the molecular formula C21H35IN4O4 and a molecular weight of 534.44 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111327527 |
| Molecular Formula | C21H35IN4O4 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCc1cc(OC)ccc1OC)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H34N4O4.HI/c1-5-22-20(24-17-10-13-25(14-11-17)21(26)29-6-2)23-12-9-16-15-18(27-3)7-8-19(16)28-4;/h7-8,15,17H,5-6,9-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | FQABBXVPBOXBSB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|