C19H30N4O4 — CID 111044464
ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111044464) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111044464 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | ethyl 4-[[N'-[2-(2,5-dimethoxyphenyl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C19H30N4O4/c1-4-27-19(24)23-11-8-15(9-12-23)22-18(20)21-10-7-14-13-16(25-2)5-6-17(14)26-3/h5-6,13,15H,4,7-12H2,1-3H3,(H3,20,21,22) |
| InChIKey | PQKGHPRMBDXTOX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|