C21H35IN4O4 — CID 111503306
ethyl 4-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111503306) has the molecular formula C21H35IN4O4 and a molecular weight of 534.44 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111503306 |
| Molecular Formula | C21H35IN4O4 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1OC)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H34N4O4.HI/c1-5-22-20(24-17-11-13-25(14-12-17)21(26)28-6-2)23-15-16(3)29-19-10-8-7-9-18(19)27-4;/h7-10,16-17H,5-6,11-15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | AFRKGJZQLXPPNA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|