C21H36IN5O2 — CID 111328683
ethyl 4-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328683) has the molecular formula C21H36IN5O2 and a molecular weight of 517.46 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328683 |
| Molecular Formula | C21H36IN5O2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | ethyl 4-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1)N(C)C)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H35N5O2.HI/c1-5-22-20(23-16-19(25(3)4)17-10-8-7-9-11-17)24-18-12-14-26(15-13-18)21(27)28-6-2;/h7-11,18-19H,5-6,12-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | KBGQIQKJIJILCO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|