C19H30BrFIN3OS — CID 109440870
2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109440870) has the molecular formula C19H30BrFIN3OS and a molecular weight of 574.34 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109440870 |
| Molecular Formula | C19H30BrFIN3OS |
| Molecular Weight | 574.34 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cc(Br)ccc1F)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C19H29BrFN3OS.HI/c1-3-22-19(23-11-10-14-12-15(20)8-9-18(14)21)24-16-6-5-7-17(13-16)26(25)4-2;/h8-9,12,16-17H,3-7,10-11,13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | NVCIKRJVWHXDJV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|