C22H32N4OS — CID 109437949
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-quinolin-8-ylethyl)guanidine (PubChem CID 109437949) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-quinolin-8-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-quinolin-8-ylethyl)guanidine |
|---|---|
| PubChem CID | 109437949 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-quinolin-8-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCc1cccc2cccnc12)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C22H32N4OS/c1-3-23-22(26-19-11-6-12-20(16-19)28(27)4-2)25-15-13-18-9-5-8-17-10-7-14-24-21(17)18/h5,7-10,14,19-20H,3-4,6,11-13,15-16H2,1-2H3,(H2,23,25,26) |
| InChIKey | ZRLZHMQVQJAETO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|