C20H33N3O3S2 — CID 109441351
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine (PubChem CID 109441351) has the molecular formula C20H33N3O3S2 and a molecular weight of 427.64 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109441351 |
| Molecular Formula | C20H33N3O3S2 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccc(S(C)(=O)=O)cc1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C20H33N3O3S2/c1-4-21-20(23-17-7-6-8-18(15-17)27(24)5-2)22-14-13-16-9-11-19(12-10-16)28(3,25)26/h9-12,17-18H,4-8,13-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | GRNKTSOSYIDPJY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|