C23H36IN5O2S — CID 109441402
1-ethyl-2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109441402) has the molecular formula C23H36IN5O2S and a molecular weight of 573.55 g/mol. Its IUPAC name is 1-ethyl-2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109441402 |
| Molecular Formula | C23H36IN5O2S |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 1-ethyl-2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(-c2nc(CC)no2)cc1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C23H35N5O2S.HI/c1-4-21-27-22(30-28-21)18-12-10-17(11-13-18)14-15-25-23(24-5-2)26-19-8-7-9-20(16-19)31(29)6-3;/h10-13,19-20H,4-9,14-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | LQKGLIISPATXKV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|