C19H33IN4OS — CID 109438516
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide (PubChem CID 109438516) has the molecular formula C19H33IN4OS and a molecular weight of 492.47 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109438516 |
| Molecular Formula | C19H33IN4OS |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(C)nc1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C19H32N4OS.HI/c1-4-20-19(21-12-11-16-10-9-15(3)22-14-16)23-17-7-6-8-18(13-17)25(24)5-2;/h9-10,14,17-18H,4-8,11-13H2,1-3H3,(H2,20,21,23);1H |
| InChIKey | WLXHKFNBPIUELO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|