C22H34N6OS — CID 109438107
2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109438107) has the molecular formula C22H34N6OS and a molecular weight of 430.62 g/mol. Its IUPAC name is 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109438107 |
| Molecular Formula | C22H34N6OS |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)nc1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C22H34N6OS/c1-5-23-22(26-19-8-7-9-20(13-19)30(29)6-2)25-15-18-10-11-21(24-14-18)28-17(4)12-16(3)27-28/h10-12,14,19-20H,5-9,13,15H2,1-4H3,(H2,23,25,26) |
| InChIKey | WSEYJASPQIUSLY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|