C17H26N6S — CID 111345503
2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111345503) has the molecular formula C17H26N6S and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111345503 |
| Molecular Formula | C17H26N6S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)nc1)NCCSC |
| InChI | InChI=1S/C17H26N6S/c1-5-18-17(19-8-9-24-4)21-12-15-6-7-16(20-11-15)23-14(3)10-13(2)22-23/h6-7,10-11H,5,8-9,12H2,1-4H3,(H2,18,19,21) |
| InChIKey | YKMUOXZYKZPQSK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|