C23H30N6O — CID 111277535
2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine (PubChem CID 111277535) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine.
| Compound Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111277535 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)nc1)NCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N6O/c1-5-24-23(25-12-13-30-21-9-6-17(2)7-10-21)27-16-20-8-11-22(26-15-20)29-19(4)14-18(3)28-29/h6-11,14-15H,5,12-13,16H2,1-4H3,(H2,24,25,27) |
| InChIKey | MEWDRNYVFBBOCR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|