C22H29IN6O — CID 111182114
2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[(4-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111182114) has the molecular formula C22H29IN6O and a molecular weight of 520.42 g/mol. Its IUPAC name is 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[(4-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111182114 |
| Molecular Formula | C22H29IN6O |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)nc1)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C22H28N6O.HI/c1-5-23-22(25-13-18-6-9-20(29-4)10-7-18)26-15-19-8-11-21(24-14-19)28-17(3)12-16(2)27-28;/h6-12,14H,5,13,15H2,1-4H3,(H2,23,25,26);1H |
| InChIKey | PENAKVWQSPFKSS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|