C23H31IN6O — CID 111169791
2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111169791) has the molecular formula C23H31IN6O and a molecular weight of 534.45 g/mol. Its IUPAC name is 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111169791 |
| Molecular Formula | C23H31IN6O |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)nc1)NCCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C23H30N6O.HI/c1-5-24-23(25-13-12-19-6-9-21(30-4)10-7-19)27-16-20-8-11-22(26-15-20)29-18(3)14-17(2)28-29;/h6-11,14-15H,5,12-13,16H2,1-4H3,(H2,24,25,27);1H |
| InChIKey | GHOIQOMPHPOXOR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|