C23H30N6O2 — CID 111202538
1-[(3,4-dimethoxyphenyl)methyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethylguanidine (PubChem CID 111202538) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethylguanidine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111202538 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)nc1)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H30N6O2/c1-6-24-23(26-13-18-7-9-20(30-4)21(12-18)31-5)27-15-19-8-10-22(25-14-19)29-17(3)11-16(2)28-29/h7-12,14H,6,13,15H2,1-5H3,(H2,24,26,27) |
| InChIKey | CWOIOGPXBQTIEB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|