C22H28N6O2 — CID 111053221
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111053221) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111053221 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | COc1ccc(CCN/C(N)=N/Cc2ccc(-n3nc(C)cc3C)nc2)cc1OC |
| InChI | InChI=1S/C22H28N6O2/c1-15-11-16(2)28(27-15)21-8-6-18(13-25-21)14-26-22(23)24-10-9-17-5-7-19(29-3)20(12-17)30-4/h5-8,11-13H,9-10,14H2,1-4H3,(H3,23,24,26) |
| InChIKey | GKOUOTJPPLDEMU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|