C22H34N4OS — CID 109440421
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(3-indol-1-ylpropyl)guanidine (PubChem CID 109440421) has the molecular formula C22H34N4OS and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(3-indol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(3-indol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109440421 |
| Molecular Formula | C22H34N4OS |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(3-indol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1ccc2ccccc21)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C22H34N4OS/c1-3-23-22(25-19-10-7-11-20(17-19)28(27)4-2)24-14-8-15-26-16-13-18-9-5-6-12-21(18)26/h5-6,9,12-13,16,19-20H,3-4,7-8,10-11,14-15,17H2,1-2H3,(H2,23,24,25) |
| InChIKey | LAXDLHXYECUZBZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|