C18H26N4 — CID 111341423
1-ethyl-2-(3-indol-1-ylpropyl)-3-(2-methylcyclopropyl)guanidine (PubChem CID 111341423) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-ethyl-2-(3-indol-1-ylpropyl)-3-(2-methylcyclopropyl)guanidine.
| Compound Name | 1-ethyl-2-(3-indol-1-ylpropyl)-3-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111341423 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-ethyl-2-(3-indol-1-ylpropyl)-3-(2-methylcyclopropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1ccc2ccccc21)NC1CC1C |
| InChI | InChI=1S/C18H26N4/c1-3-19-18(21-16-13-14(16)2)20-10-6-11-22-12-9-15-7-4-5-8-17(15)22/h4-5,7-9,12,14,16H,3,6,10-11,13H2,1-2H3,(H2,19,20,21) |
| InChIKey | ACFMJSIINXWGGO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|