C24H40N6 — CID 111341379
1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-(3-indol-1-ylpropyl)guanidine (PubChem CID 111341379) has the molecular formula C24H40N6 and a molecular weight of 412.63 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-(3-indol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-(3-indol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111341379 |
| Molecular Formula | C24H40N6 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-(3-indol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1ccc2ccccc21)NCCCCN1CCN(CC)CC1 |
| InChI | InChI=1S/C24H40N6/c1-3-25-24(26-13-7-8-15-29-20-18-28(4-2)19-21-29)27-14-9-16-30-17-12-22-10-5-6-11-23(22)30/h5-6,10-12,17H,3-4,7-9,13-16,18-21H2,1-2H3,(H2,25,26,27) |
| InChIKey | FUDGLHHXXFWBPO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|