C19H27IN6O2 — CID 111830782
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111830782) has the molecular formula C19H27IN6O2 and a molecular weight of 498.37 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111830782 |
| Molecular Formula | C19H27IN6O2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1ccc2ccccc21)NCCN1C(=O)CNC1=O.I |
| InChI | InChI=1S/C19H26N6O2.HI/c1-2-20-18(22-10-13-25-17(26)14-23-19(25)27)21-9-5-11-24-12-8-15-6-3-4-7-16(15)24;/h3-4,6-8,12H,2,5,9-11,13-14H2,1H3,(H,23,27)(H2,20,21,22);1H |
| InChIKey | PMSRYXJIDYXJQN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|