C11H22IN5O2 — CID 111829030
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide (PubChem CID 111829030) has the molecular formula C11H22IN5O2 and a molecular weight of 383.23 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111829030 |
| Molecular Formula | C11H22IN5O2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide |
| SMILES | CCC/N=C(\NCC)NCCN1C(=O)CNC1=O.I |
| InChI | InChI=1S/C11H21N5O2.HI/c1-3-5-13-10(12-4-2)14-6-7-16-9(17)8-15-11(16)18;/h3-8H2,1-2H3,(H,15,18)(H2,12,13,14);1H |
| InChIKey | MNHZQELKLPIGPY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|