C12H24IN5O2 — CID 111827930
2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111827930) has the molecular formula C12H24IN5O2 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111827930 |
| Molecular Formula | C12H24IN5O2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCCC/N=C(\NCC)NCCN1C(=O)CNC1=O.I |
| InChI | InChI=1S/C12H23N5O2.HI/c1-3-5-6-14-11(13-4-2)15-7-8-17-10(18)9-16-12(17)19;/h3-9H2,1-2H3,(H,16,19)(H2,13,14,15);1H |
| InChIKey | VFJFBFORQQDCDJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|