C10H19N5O2 — CID 111812527
2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine (PubChem CID 111812527) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine.
| Compound Name | 2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111812527 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-butyl-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine |
| SMILES | CCCC/N=C(\N)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C10H19N5O2/c1-2-3-4-12-9(11)13-5-6-15-8(16)7-14-10(15)17/h2-7H2,1H3,(H,14,17)(H3,11,12,13) |
| InChIKey | NJTAPAJMFFJKTE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|