C16H24IN5O2 — CID 111812452
1-(2,6-diethylphenyl)-2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111812452) has the molecular formula C16H24IN5O2 and a molecular weight of 445.31 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,6-diethylphenyl)-2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111812452 |
| Molecular Formula | C16H24IN5O2 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/CCN1C(=O)CNC1=O.I |
| InChI | InChI=1S/C16H23N5O2.HI/c1-3-11-6-5-7-12(4-2)14(11)20-15(17)18-8-9-21-13(22)10-19-16(21)23;/h5-7H,3-4,8-10H2,1-2H3,(H,19,23)(H3,17,18,20);1H |
| InChIKey | LZHCWUCUKUIAFW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|