C13H22N4O2S — CID 111046599
1-(2,6-diethylphenyl)-2-(2-sulfamoylethyl)guanidine (PubChem CID 111046599) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-(2,6-diethylphenyl)-2-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111046599 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-(2-sulfamoylethyl)guanidine |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/CCS(N)(=O)=O |
| InChI | InChI=1S/C13H22N4O2S/c1-3-10-6-5-7-11(4-2)12(10)17-13(14)16-8-9-20(15,18)19/h5-7H,3-4,8-9H2,1-2H3,(H3,14,16,17)(H2,15,18,19) |
| InChIKey | QDUDVMLKXKAMOG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|