C15H26IN3 — CID 110912607
1-(2,6-diethylphenyl)-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 110912607) has the molecular formula C15H26IN3 and a molecular weight of 375.30 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(2,6-diethylphenyl)-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110912607 |
| Molecular Formula | C15H26IN3 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/CC(C)C.I |
| InChI | InChI=1S/C15H25N3.HI/c1-5-12-8-7-9-13(6-2)14(12)18-15(16)17-10-11(3)4;/h7-9,11H,5-6,10H2,1-4H3,(H3,16,17,18);1H |
| InChIKey | VOIKLOQMAPGTRC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|