C21H29IN4O — CID 111086226
N-[4-[2-[[amino-(2,6-diethylanilino)methylidene]amino]ethyl]phenyl]acetamide;hydroiodide (PubChem CID 111086226) has the molecular formula C21H29IN4O and a molecular weight of 480.39 g/mol. Its IUPAC name is N-[4-[2-[[amino-(2,6-diethylanilino)methylidene]amino]ethyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[4-[2-[[amino-(2,6-diethylanilino)methylidene]amino]ethyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111086226 |
| Molecular Formula | C21H29IN4O |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[4-[2-[[amino-(2,6-diethylanilino)methylidene]amino]ethyl]phenyl]acetamide;hydroiodide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/CCc1ccc(NC(C)=O)cc1.I |
| InChI | InChI=1S/C21H28N4O.HI/c1-4-17-7-6-8-18(5-2)20(17)25-21(22)23-14-13-16-9-11-19(12-10-16)24-15(3)26;/h6-12H,4-5,13-14H2,1-3H3,(H,24,26)(H3,22,23,25);1H |
| InChIKey | RABUMQBKBLWSPY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|