C14H22IN7 — CID 120603199
1-(2,6-diethylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 120603199) has the molecular formula C14H22IN7 and a molecular weight of 415.28 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,6-diethylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120603199 |
| Molecular Formula | C14H22IN7 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/Cc1nnn(C)n1.I |
| InChI | InChI=1S/C14H21N7.HI/c1-4-10-7-6-8-11(5-2)13(10)17-14(15)16-9-12-18-20-21(3)19-12;/h6-8H,4-5,9H2,1-3H3,(H3,15,16,17);1H |
| InChIKey | XUXOUEMMHNVPLE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|