C14H22IN7 — CID 120603191
1-(4-butan-2-ylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 120603191) has the molecular formula C14H22IN7 and a molecular weight of 415.28 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(4-butan-2-ylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120603191 |
| Molecular Formula | C14H22IN7 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-2-[(2-methyltetrazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(C)c1ccc(N/C(N)=N/Cc2nnn(C)n2)cc1.I |
| InChI | InChI=1S/C14H21N7.HI/c1-4-10(2)11-5-7-12(8-6-11)17-14(15)16-9-13-18-20-21(3)19-13;/h5-8,10H,4,9H2,1-3H3,(H3,15,16,17);1H |
| InChIKey | DPQPZMKFFCYJGP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|