C18H26IN5 — CID 120913691
1-(4-butan-2-ylphenyl)-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 120913691) has the molecular formula C18H26IN5 and a molecular weight of 439.35 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(4-butan-2-ylphenyl)-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120913691 |
| Molecular Formula | C18H26IN5 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(C)c1ccc(N/C(N)=N/Cc2cc(C)nc(C)n2)cc1.I |
| InChI | InChI=1S/C18H25N5.HI/c1-5-12(2)15-6-8-16(9-7-15)23-18(19)20-11-17-10-13(3)21-14(4)22-17;/h6-10,12H,5,11H2,1-4H3,(H3,19,20,23);1H |
| InChIKey | ZIRDXCANZOYHHI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|