C18H28IN5 — CID 111098480
1-(2,6-diethylphenyl)-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111098480) has the molecular formula C18H28IN5 and a molecular weight of 441.36 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2,6-diethylphenyl)-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111098480 |
| Molecular Formula | C18H28IN5 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/CCCc1cnn(C)c1.I |
| InChI | InChI=1S/C18H27N5.HI/c1-4-15-9-6-10-16(5-2)17(15)22-18(19)20-11-7-8-14-12-21-23(3)13-14;/h6,9-10,12-13H,4-5,7-8,11H2,1-3H3,(H3,19,20,22);1H |
| InChIKey | AXUAXZIAEQDERK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|