C13H18IN5 — CID 110916157
2-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenylguanidine;hydroiodide (PubChem CID 110916157) has the molecular formula C13H18IN5 and a molecular weight of 371.23 g/mol. Its IUPAC name is 2-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110916157 |
| Molecular Formula | C13H18IN5 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenylguanidine;hydroiodide |
| SMILES | Cn1cc(CC/N=C(\N)Nc2ccccc2)cn1.I |
| InChI | InChI=1S/C13H17N5.HI/c1-18-10-11(9-16-18)7-8-15-13(14)17-12-5-3-2-4-6-12;/h2-6,9-10H,7-8H2,1H3,(H3,14,15,17);1H |
| InChIKey | CTJJQMGPVDZDDU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|