C14H19N5O2 — CID 111812529
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(2-phenylethyl)guanidine (PubChem CID 111812529) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(2-phenylethyl)guanidine.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111812529 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(2-phenylethyl)guanidine |
| SMILES | N/C(=N\CCc1ccccc1)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C14H19N5O2/c15-13(16-7-6-11-4-2-1-3-5-11)17-8-9-19-12(20)10-18-14(19)21/h1-5H,6-10H2,(H,18,21)(H3,15,16,17) |
| InChIKey | OVCLGJLJXHOUEW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|