C17H22N4O5 — CID 122002067
4-[2-(2,5-dioxoimidazolidin-1-yl)ethylcarbamoylamino]-5-phenylpentanoic acid (PubChem CID 122002067) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[2-(2,5-dioxoimidazolidin-1-yl)ethylcarbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[2-(2,5-dioxoimidazolidin-1-yl)ethylcarbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122002067 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-[2-(2,5-dioxoimidazolidin-1-yl)ethylcarbamoylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C17H22N4O5/c22-14-11-19-17(26)21(14)9-8-18-16(25)20-13(6-7-15(23)24)10-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,19,26)(H,23,24)(H2,18,20,25) |
| InChIKey | NEPHMCHIJXWSCH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|