C15H22N2O5 — CID 122028316
4-(1,3-dihydroxypropan-2-ylcarbamoylamino)-5-phenylpentanoic acid (PubChem CID 122028316) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-(1,3-dihydroxypropan-2-ylcarbamoylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(1,3-dihydroxypropan-2-ylcarbamoylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122028316 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-(1,3-dihydroxypropan-2-ylcarbamoylamino)-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NC(CO)CO |
| InChI | InChI=1S/C15H22N2O5/c18-9-13(10-19)17-15(22)16-12(6-7-14(20)21)8-11-4-2-1-3-5-11/h1-5,12-13,18-19H,6-10H2,(H,20,21)(H2,16,17,22) |
| InChIKey | AHJJKZMRNZEQFL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |