C16H22N2O4 — CID 122027620
4-(1-hydroxybut-3-en-2-ylcarbamoylamino)-5-phenylpentanoic acid (PubChem CID 122027620) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-(1-hydroxybut-3-en-2-ylcarbamoylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(1-hydroxybut-3-en-2-ylcarbamoylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027620 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-(1-hydroxybut-3-en-2-ylcarbamoylamino)-5-phenylpentanoic acid |
| SMILES | C=CC(CO)NC(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-2-13(11-19)17-16(22)18-14(8-9-15(20)21)10-12-6-4-3-5-7-12/h2-7,13-14,19H,1,8-11H2,(H,20,21)(H2,17,18,22) |
| InChIKey | ZHODBVORZQHMMV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|