C17H23F3N2O3 — CID 122009996
5-phenyl-4-(1,1,1-trifluoropentan-3-ylcarbamoylamino)pentanoic acid (PubChem CID 122009996) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is 5-phenyl-4-(1,1,1-trifluoropentan-3-ylcarbamoylamino)pentanoic acid.
| Compound Name | 5-phenyl-4-(1,1,1-trifluoropentan-3-ylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 122009996 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 5-phenyl-4-(1,1,1-trifluoropentan-3-ylcarbamoylamino)pentanoic acid |
| SMILES | CCC(CC(F)(F)F)NC(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-2-13(11-17(18,19)20)21-16(25)22-14(8-9-15(23)24)10-12-6-4-3-5-7-12/h3-7,13-14H,2,8-11H2,1H3,(H,23,24)(H2,21,22,25) |
| InChIKey | ARLUAHSQYUXYHE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |