C16H23FN2O3 — CID 122015478
4-(3-fluorobutylcarbamoylamino)-5-phenylpentanoic acid (PubChem CID 122015478) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is 4-(3-fluorobutylcarbamoylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(3-fluorobutylcarbamoylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122015478 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-(3-fluorobutylcarbamoylamino)-5-phenylpentanoic acid |
| SMILES | CC(F)CCNC(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C16H23FN2O3/c1-12(17)9-10-18-16(22)19-14(7-8-15(20)21)11-13-5-3-2-4-6-13/h2-6,12,14H,7-11H2,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | GWHBBOSCVBCSCC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |