C20H32N2O4 — CID 122028274
4-[(3-hydroxy-2,2,4-trimethylpentyl)carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122028274) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(3-hydroxy-2,2,4-trimethylpentyl)carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(3-hydroxy-2,2,4-trimethylpentyl)carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122028274 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-[(3-hydroxy-2,2,4-trimethylpentyl)carbamoylamino]-5-phenylpentanoic acid |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C20H32N2O4/c1-14(2)18(25)20(3,4)13-21-19(26)22-16(10-11-17(23)24)12-15-8-6-5-7-9-15/h5-9,14,16,18,25H,10-13H2,1-4H3,(H,23,24)(H2,21,22,26) |
| InChIKey | UUICPZYHMPENLB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |