C19H30N2O4 — CID 122028284
4-[(2-methoxy-3,3-dimethylbutyl)carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122028284) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[(2-methoxy-3,3-dimethylbutyl)carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(2-methoxy-3,3-dimethylbutyl)carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122028284 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 4-[(2-methoxy-3,3-dimethylbutyl)carbamoylamino]-5-phenylpentanoic acid |
| SMILES | COC(CNC(=O)NC(CCC(=O)O)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H30N2O4/c1-19(2,3)16(25-4)13-20-18(24)21-15(10-11-17(22)23)12-14-8-6-5-7-9-14/h5-9,15-16H,10-13H2,1-4H3,(H,22,23)(H2,20,21,24) |
| InChIKey | SEJHUMNUCIPFJM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |