C21H25FN2O4 — CID 122004564
4-[[2-(4-fluorophenyl)-2-methoxyethyl]carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122004564) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)-2-methoxyethyl]carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[2-(4-fluorophenyl)-2-methoxyethyl]carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122004564 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)-2-methoxyethyl]carbamoylamino]-5-phenylpentanoic acid |
| SMILES | COC(CNC(=O)NC(CCC(=O)O)Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O4/c1-28-19(16-7-9-17(22)10-8-16)14-23-21(27)24-18(11-12-20(25)26)13-15-5-3-2-4-6-15/h2-10,18-19H,11-14H2,1H3,(H,25,26)(H2,23,24,27) |
| InChIKey | RMQQRQDMZLEWBX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |